C8H8N6 — CID 21420545
3,4-diaminobutane-1,1,1,2-tetracarbonitrile (PubChem CID 21420545) has the molecular formula C8H8N6 and a molecular weight of 188.19 g/mol. Its IUPAC name is 3,4-diaminobutane-1,1,1,2-tetracarbonitrile.
| Compound Name | 3,4-diaminobutane-1,1,1,2-tetracarbonitrile |
|---|---|
| PubChem CID | 21420545 |
| Molecular Formula | C8H8N6 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 3,4-diaminobutane-1,1,1,2-tetracarbonitrile |
| SMILES | N#CC(C(N)CN)C(C#N)(C#N)C#N |
| InChI | InChI=1S/C8H8N6/c9-1-6(7(14)2-10)8(3-11,4-12)5-13/h6-7H,2,10,14H2 |
| InChIKey | RLOLHQGGROASOU-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 147.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |