About hexanimidamide;hydrochloride
hexanimidamide;hydrochloride (PubChem CID 21420651) has the molecular formula C6H15ClN2
and a molecular weight of 150.65 g/mol. Its IUPAC name is hexanimidamide;hydrochloride.
Molecular Properties
| Compound Name | hexanimidamide;hydrochloride |
| PubChem CID | 21420651 |
| Molecular Formula | C6H15ClN2 |
| Molecular Weight | 150.65 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | hexanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(/N)CCCCC |
| InChI | InChI=1S/C6H14N2.ClH/c1-2-3-4-5-6(7)8;/h2-5H2,1H3,(H3,7,8);1H |
| InChIKey | IQYXAKDFVUKMLW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.65 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze hexanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanimidamide;hydrochloride?
The IUPAC name of hexanimidamide;hydrochloride (CID 21420651) is hexanimidamide;hydrochloride.
What is the SMILES notation for hexanimidamide;hydrochloride?
The canonical SMILES for hexanimidamide;hydrochloride is Cl.[H]/N=C(/N)CCCCC.
What is the InChIKey of hexanimidamide;hydrochloride?
The InChIKey is IQYXAKDFVUKMLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.ClH/c1-2-3-4-5-6(7)8;/h2-5H2,1H3,(H3,7,8);1H.
What are the key properties of hexanimidamide;hydrochloride?
hexanimidamide;hydrochloride has a molecular weight of 150.65 g/mol, XLogP of 1.92, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexanimidamide;hydrochloride is sourced from PubChem (CID 21420651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).