About 2-aminododecanal
2-aminododecanal (PubChem CID 21420686) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is 2-aminododecanal.
Molecular Properties
| Compound Name | 2-aminododecanal |
| PubChem CID | 21420686 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | 2-aminododecanal |
| SMILES | CCCCCCCCCCC(N)C=O |
| InChI | InChI=1S/C12H25NO/c1-2-3-4-5-6-7-8-9-10-12(13)11-14/h11-12H,2-10,13H2,1H3 |
| InChIKey | MBVMMSONKHZAQF-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-aminododecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminododecanal?
The IUPAC name of 2-aminododecanal (CID 21420686) is 2-aminododecanal.
What is the SMILES notation for 2-aminododecanal?
The canonical SMILES for 2-aminododecanal is CCCCCCCCCCC(N)C=O.
What is the InChIKey of 2-aminododecanal?
The InChIKey is MBVMMSONKHZAQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO/c1-2-3-4-5-6-7-8-9-10-12(13)11-14/h11-12H,2-10,13H2,1H3.
What are the key properties of 2-aminododecanal?
2-aminododecanal has a molecular weight of 199.34 g/mol, XLogP of 3.04, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminododecanal is sourced from PubChem (CID 21420686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).