C32H32N2O8 — CID 21421374
4,8-bis[1-(2,5-dihydroxyphenyl)propan-2-ylamino]anthracene-1,5,9,10-tetrol (PubChem CID 21421374) has the molecular formula C32H32N2O8 and a molecular weight of 572.61 g/mol. Its IUPAC name is 4,8-bis[1-(2,5-dihydroxyphenyl)propan-2-ylamino]anthracene-1,5,9,10-tetrol.
| Compound Name | 4,8-bis[1-(2,5-dihydroxyphenyl)propan-2-ylamino]anthracene-1,5,9,10-tetrol |
|---|---|
| PubChem CID | 21421374 |
| Molecular Formula | C32H32N2O8 |
| Molecular Weight | 572.61 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 4,8-bis[1-(2,5-dihydroxyphenyl)propan-2-ylamino]anthracene-1,5,9,10-tetrol |
| SMILES | CC(Cc1cc(O)ccc1O)Nc1ccc(O)c2c(O)c3c(NC(C)Cc4cc(O)ccc4O)ccc(O)c3c(O)c12 |
| InChI | InChI=1S/C32H32N2O8/c1-15(11-17-13-19(35)3-7-23(17)37)33-21-5-9-25(39)29-27(21)31(41)30-26(40)10-6-22(28(30)32(29)42)34-16(2)12-18-14-20(36)4-8-24(18)38/h3-10,13-16,33-42H,11-12H2,1-2H3 |
| InChIKey | MPJAMABNNGYJGF-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 185.90 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|