C25H38N2O2 — CID 21422430
N'-[1-[4-[3-(4-tert-butylphenoxy)propoxy]phenyl]ethyl]-N-methylpropane-1,3-diamine (PubChem CID 21422430) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is N'-[1-[4-[3-(4-tert-butylphenoxy)propoxy]phenyl]ethyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[1-[4-[3-(4-tert-butylphenoxy)propoxy]phenyl]ethyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 21422430 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | N'-[1-[4-[3-(4-tert-butylphenoxy)propoxy]phenyl]ethyl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNC(C)c1ccc(OCCCOc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H38N2O2/c1-20(27-17-6-16-26-5)21-8-12-23(13-9-21)28-18-7-19-29-24-14-10-22(11-15-24)25(2,3)4/h8-15,20,26-27H,6-7,16-19H2,1-5H3 |
| InChIKey | KFYSMWHXPJPTLM-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|