C10H17N3O3 — CID 21422951
1-(1-aminoethyl)-5,5-diethyl-1,3-diazinane-2,4,6-trione (PubChem CID 21422951) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-(1-aminoethyl)-5,5-diethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(1-aminoethyl)-5,5-diethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 21422951 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 1-(1-aminoethyl)-5,5-diethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)NC(=O)N(C(C)N)C1=O |
| InChI | InChI=1S/C10H17N3O3/c1-4-10(5-2)7(14)12-9(16)13(6(3)11)8(10)15/h6H,4-5,11H2,1-3H3,(H,12,14,16) |
| InChIKey | CBXWSWDWWCPQOR-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|