morpholine-4-carboxamide;oxalic acid

C7H12N2O6 — CID 21425360

IUPACmorpholine-4-carboxamide;oxalic acid
SMILESNC(=O)N1CCOCC1.O=C(O)C(=O)O
InChIInChI=1S/C5H10N2O2.C2H2O4/c6-5(8)7-1-3-9-4-2-7;3-1(4)2(5)6/h1-4H2,(H2,6,8);(H,3,4)(H,5,6)
InChIKeySRSBSIJZMDYUKZ-UHFFFAOYSA-N
MW220.18 g/mol
LogP-1.45
Rot. Bonds

About morpholine-4-carboxamide;oxalic acid

morpholine-4-carboxamide;oxalic acid (PubChem CID 21425360) has the molecular formula C7H12N2O6 and a molecular weight of 220.18 g/mol. Its IUPAC name is morpholine-4-carboxamide;oxalic acid.

Molecular Properties

Compound Namemorpholine-4-carboxamide;oxalic acid
PubChem CID21425360
Molecular FormulaC7H12N2O6
Molecular Weight220.18 g/mol
Exact Mass220.07
IUPAC Namemorpholine-4-carboxamide;oxalic acid
SMILESNC(=O)N1CCOCC1.O=C(O)C(=O)O
InChIInChI=1S/C5H10N2O2.C2H2O4/c6-5(8)7-1-3-9-4-2-7;3-1(4)2(5)6/h1-4H2,(H2,6,8);(H,3,4)(H,5,6)
InChIKeySRSBSIJZMDYUKZ-UHFFFAOYSA-N
XLogP-1.45
TPSA130.16 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.18
LogP ≤ 5-1.45
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze morpholine-4-carboxamide;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of morpholine-4-carboxamide;oxalic acid?
The IUPAC name of morpholine-4-carboxamide;oxalic acid (CID 21425360) is morpholine-4-carboxamide;oxalic acid.
What is the SMILES notation for morpholine-4-carboxamide;oxalic acid?
The canonical SMILES for morpholine-4-carboxamide;oxalic acid is NC(=O)N1CCOCC1.O=C(O)C(=O)O.
What is the InChIKey of morpholine-4-carboxamide;oxalic acid?
The InChIKey is SRSBSIJZMDYUKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O2.C2H2O4/c6-5(8)7-1-3-9-4-2-7;3-1(4)2(5)6/h1-4H2,(H2,6,8);(H,3,4)(H,5,6).
What are the key properties of morpholine-4-carboxamide;oxalic acid?
morpholine-4-carboxamide;oxalic acid has a molecular weight of 220.18 g/mol, XLogP of -1.45, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine-4-carboxamide;oxalic acid is sourced from PubChem (CID 21425360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).