About N-propan-2-yl-2H-1,3,5-triazin-1-amine
N-propan-2-yl-2H-1,3,5-triazin-1-amine (PubChem CID 21425854) has the molecular formula C6H12N4
and a molecular weight of 140.19 g/mol. Its IUPAC name is N-propan-2-yl-2H-1,3,5-triazin-1-amine.
Molecular Properties
| Compound Name | N-propan-2-yl-2H-1,3,5-triazin-1-amine |
| PubChem CID | 21425854 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | N-propan-2-yl-2H-1,3,5-triazin-1-amine |
| SMILES | CC(C)NN1C=NC=NC1 |
| InChI | InChI=1S/C6H12N4/c1-6(2)9-10-4-7-3-8-5-10/h3-4,6,9H,5H2,1-2H3 |
| InChIKey | HBOUKZDLIUDGKU-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-propan-2-yl-2H-1,3,5-triazin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-2H-1,3,5-triazin-1-amine?
The IUPAC name of N-propan-2-yl-2H-1,3,5-triazin-1-amine (CID 21425854) is N-propan-2-yl-2H-1,3,5-triazin-1-amine.
What is the SMILES notation for N-propan-2-yl-2H-1,3,5-triazin-1-amine?
The canonical SMILES for N-propan-2-yl-2H-1,3,5-triazin-1-amine is CC(C)NN1C=NC=NC1.
What is the InChIKey of N-propan-2-yl-2H-1,3,5-triazin-1-amine?
The InChIKey is HBOUKZDLIUDGKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4/c1-6(2)9-10-4-7-3-8-5-10/h3-4,6,9H,5H2,1-2H3.
What are the key properties of N-propan-2-yl-2H-1,3,5-triazin-1-amine?
N-propan-2-yl-2H-1,3,5-triazin-1-amine has a molecular weight of 140.19 g/mol, XLogP of 0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-2H-1,3,5-triazin-1-amine is sourced from PubChem (CID 21425854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).