C21H42ClN5O2 — CID 21425857
1-chloro-3,5-bis[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]-1,3,5-triazinane (PubChem CID 21425857) has the molecular formula C21H42ClN5O2 and a molecular weight of 432.05 g/mol. Its IUPAC name is 1-chloro-3,5-bis[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]-1,3,5-triazinane.
| Compound Name | 1-chloro-3,5-bis[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]-1,3,5-triazinane |
|---|---|
| PubChem CID | 21425857 |
| Molecular Formula | C21H42ClN5O2 |
| Molecular Weight | 432.05 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | 1-chloro-3,5-bis[(2,2,6,6-tetramethylpiperidin-1-yl)oxy]-1,3,5-triazinane |
| SMILES | CC1(C)CCCC(C)(C)N1ON1CN(Cl)CN(ON2C(C)(C)CCCC2(C)C)C1 |
| InChI | InChI=1S/C21H42ClN5O2/c1-18(2)11-9-12-19(3,4)26(18)28-24-15-23(22)16-25(17-24)29-27-20(5,6)13-10-14-21(27,7)8/h9-17H2,1-8H3 |
| InChIKey | HCUBKAHOHWTYPA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 34.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.05 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|