About Silabutane-2-thiol
Silabutane-2-thiol (PubChem CID 21425877) has the molecular formula C3H7SSi
and a molecular weight of 103.24 g/mol.
Molecular Properties
| Compound Name | Silabutane-2-thiol |
| PubChem CID | 21425877 |
| Molecular Formula | C3H7SSi |
| Molecular Weight | 103.24 g/mol |
| Exact Mass | 103.00 |
| IUPAC Name | — |
| SMILES | CCC([Si])S |
| InChI | InChI=1S/C3H7SSi/c1-2-3(4)5/h3-4H,2H2,1H3 |
| InChIKey | CMYQXYZMWNLOKN-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 1.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | 22 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze Silabutane-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Silabutane-2-thiol?
The IUPAC name of Silabutane-2-thiol (CID 21425877) is not available.
What is the SMILES notation for Silabutane-2-thiol?
The canonical SMILES for Silabutane-2-thiol is CCC([Si])S.
What is the InChIKey of Silabutane-2-thiol?
The InChIKey is CMYQXYZMWNLOKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7SSi/c1-2-3(4)5/h3-4H,2H2,1H3.
What are the key properties of Silabutane-2-thiol?
Silabutane-2-thiol has a molecular weight of 103.24 g/mol, XLogP of not available, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Silabutane-2-thiol is sourced from PubChem (CID 21425877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).