About 1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine
1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine (PubChem CID 21426355) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is 1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine.
Molecular Properties
| Compound Name | 1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine |
| PubChem CID | 21426355 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine |
| SMILES | C=CCNC.C=CN1CCN(C=C)CC1 |
| InChI | InChI=1S/C8H14N2.C4H9N/c1-3-9-5-7-10(4-2)8-6-9;1-3-4-5-2/h3-4H,1-2,5-8H2;3,5H,1,4H2,2H3 |
| InChIKey | HZEBWXWGHFPHIH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine?
The IUPAC name of 1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine (CID 21426355) is 1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine.
What is the SMILES notation for 1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine?
The canonical SMILES for 1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine is C=CCNC.C=CN1CCN(C=C)CC1.
What is the InChIKey of 1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine?
The InChIKey is HZEBWXWGHFPHIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2.C4H9N/c1-3-9-5-7-10(4-2)8-6-9;1-3-4-5-2/h3-4H,1-2,5-8H2;3,5H,1,4H2,2H3.
What are the key properties of 1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine?
1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine has a molecular weight of 209.34 g/mol, XLogP of 1.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(ethenyl)piperazine;N-methylprop-2-en-1-amine is sourced from PubChem (CID 21426355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).