C8H18N2O6P2 — CID 21426435
[1-ethyl-3-(ethylamino)-2-hydroxy-2,6-dioxo-1,2λ5-azaphosphinan-3-yl]phosphonic acid (PubChem CID 21426435) has the molecular formula C8H18N2O6P2 and a molecular weight of 300.19 g/mol. Its IUPAC name is [1-ethyl-3-(ethylamino)-2-hydroxy-2,6-dioxo-1,2λ5-azaphosphinan-3-yl]phosphonic acid.
| Compound Name | [1-ethyl-3-(ethylamino)-2-hydroxy-2,6-dioxo-1,2λ5-azaphosphinan-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 21426435 |
| Molecular Formula | C8H18N2O6P2 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | [1-ethyl-3-(ethylamino)-2-hydroxy-2,6-dioxo-1,2λ5-azaphosphinan-3-yl]phosphonic acid |
| SMILES | CCNC1(P(=O)(O)O)CCC(=O)N(CC)P1(=O)O |
| InChI | InChI=1S/C8H18N2O6P2/c1-3-9-8(18(14,15)16)6-5-7(11)10(4-2)17(8,12)13/h9H,3-6H2,1-2H3,(H,12,13)(H2,14,15,16) |
| InChIKey | YDFMZMMMKBPJEA-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|