About N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride
N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride (PubChem CID 21426761) has the molecular formula C10H13FN4S
and a molecular weight of 240.31 g/mol. Its IUPAC name is N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride.
Molecular Properties
| Compound Name | N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride |
| PubChem CID | 21426761 |
| Molecular Formula | C10H13FN4S |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride |
| SMILES | CC(C)c1nsc(/N=C(/F)N(C)C)c1C#N |
| InChI | InChI=1S/C10H13FN4S/c1-6(2)8-7(5-12)9(16-14-8)13-10(11)15(3)4/h6H,1-4H3/b13-10- |
| InChIKey | PCVUPKMXTDPXMM-RAXLEYEMSA-N |
| XLogP | 2.66 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride?
The IUPAC name of N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride (CID 21426761) is N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride.
What is the SMILES notation for N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride?
The canonical SMILES for N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride is CC(C)c1nsc(/N=C(/F)N(C)C)c1C#N.
What is the InChIKey of N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride?
The InChIKey is PCVUPKMXTDPXMM-RAXLEYEMSA-N. The full InChI is InChI=1S/C10H13FN4S/c1-6(2)8-7(5-12)9(16-14-8)13-10(11)15(3)4/h6H,1-4H3/b13-10-.
What are the key properties of N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride?
N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride has a molecular weight of 240.31 g/mol, XLogP of 2.66, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-cyano-3-propan-2-yl-1,2-thiazol-5-yl)-N,N-dimethylcarbamimidoyl fluoride is sourced from PubChem (CID 21426761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).