About methyl 3-iminopentanoate
methyl 3-iminopentanoate (PubChem CID 21426790) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is methyl 3-iminopentanoate.
Molecular Properties
| Compound Name | methyl 3-iminopentanoate |
| PubChem CID | 21426790 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | methyl 3-iminopentanoate |
| SMILES | [H]/N=C(\CC)CC(=O)OC |
| InChI | InChI=1S/C6H11NO2/c1-3-5(7)4-6(8)9-2/h7H,3-4H2,1-2H3/b7-5+ |
| InChIKey | GELLTMRVYFWOAD-FNORWQNLSA-N |
| XLogP | 0.98 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-iminopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-iminopentanoate?
The IUPAC name of methyl 3-iminopentanoate (CID 21426790) is methyl 3-iminopentanoate.
What is the SMILES notation for methyl 3-iminopentanoate?
The canonical SMILES for methyl 3-iminopentanoate is [H]/N=C(\CC)CC(=O)OC.
What is the InChIKey of methyl 3-iminopentanoate?
The InChIKey is GELLTMRVYFWOAD-FNORWQNLSA-N. The full InChI is InChI=1S/C6H11NO2/c1-3-5(7)4-6(8)9-2/h7H,3-4H2,1-2H3/b7-5+.
What are the key properties of methyl 3-iminopentanoate?
methyl 3-iminopentanoate has a molecular weight of 129.16 g/mol, XLogP of 0.98, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-iminopentanoate is sourced from PubChem (CID 21426790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).