About 1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene
1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene (PubChem CID 21427024) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is 1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene.
Molecular Properties
| Compound Name | 1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene |
| PubChem CID | 21427024 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene |
| SMILES | C1=CC2=C3C(C1)CCCN3CCC2 |
| InChI | InChI=1S/C12H17N/c1-4-10-6-2-8-13-9-3-7-11(5-1)12(10)13/h1,4,11H,2-3,5-9H2 |
| InChIKey | PBTANKCFBWZVEO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene?
The IUPAC name of 1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene (CID 21427024) is 1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene.
What is the SMILES notation for 1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene?
The canonical SMILES for 1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene is C1=CC2=C3C(C1)CCCN3CCC2.
What is the InChIKey of 1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene?
The InChIKey is PBTANKCFBWZVEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-4-10-6-2-8-13-9-3-7-11(5-1)12(10)13/h1,4,11H,2-3,5-9H2.
What are the key properties of 1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene?
1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene has a molecular weight of 175.28 g/mol, XLogP of 2.71, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azatricyclo[7.3.1.05,13]trideca-5(13),6-diene is sourced from PubChem (CID 21427024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).