C30H54O2 — CID 21427342
2,6,10,15,19,23-hexamethyltetracosa-11,13-diyne-10,15-diol (PubChem CID 21427342) has the molecular formula C30H54O2 and a molecular weight of 446.76 g/mol. Its IUPAC name is 2,6,10,15,19,23-hexamethyltetracosa-11,13-diyne-10,15-diol.
| Compound Name | 2,6,10,15,19,23-hexamethyltetracosa-11,13-diyne-10,15-diol |
|---|---|
| PubChem CID | 21427342 |
| Molecular Formula | C30H54O2 |
| Molecular Weight | 446.76 g/mol |
| Exact Mass | 446.41 |
| IUPAC Name | 2,6,10,15,19,23-hexamethyltetracosa-11,13-diyne-10,15-diol |
| SMILES | CC(C)CCCC(C)CCCC(C)(O)C#CC#CC(C)(O)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C30H54O2/c1-25(2)15-11-17-27(5)19-13-23-29(7,31)21-9-10-22-30(8,32)24-14-20-28(6)18-12-16-26(3)4/h25-28,31-32H,11-20,23-24H2,1-8H3 |
| InChIKey | OVDIZOACBQOBPT-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.76 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|