About 2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole
2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 21427660) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
Analyze 2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole?
The IUPAC name of 2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (CID 21427660) is 2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
What is the SMILES notation for 2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole?
The canonical SMILES for 2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole is CCN1CC2CCCC2C1.
What is the InChIKey of 2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole?
The InChIKey is GYPZELCJLZCMED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-2-10-6-8-4-3-5-9(8)7-10/h8-9H,2-7H2,1H3.
What are the key properties of 2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole?
2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole has a molecular weight of 139.24 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole is sourced from PubChem (CID 21427660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).