C21H24F3NO2 — CID 21427661
ethyl 2-[benzyl-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]amino]acetate (PubChem CID 21427661) has the molecular formula C21H24F3NO2 and a molecular weight of 379.42 g/mol. Its IUPAC name is ethyl 2-[benzyl-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]amino]acetate.
| Compound Name | ethyl 2-[benzyl-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 21427661 |
| Molecular Formula | C21H24F3NO2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | ethyl 2-[benzyl-[1-[3-(trifluoromethyl)phenyl]propan-2-yl]amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccccc1)C(C)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H24F3NO2/c1-3-27-20(26)15-25(14-17-8-5-4-6-9-17)16(2)12-18-10-7-11-19(13-18)21(22,23)24/h4-11,13,16H,3,12,14-15H2,1-2H3 |
| InChIKey | MWDIRDPUQDTTLX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |