About 2-isocyanatoethyl 2-isocyanatopropanoate
2-isocyanatoethyl 2-isocyanatopropanoate (PubChem CID 21427725) has the molecular formula C7H8N2O4
and a molecular weight of 184.15 g/mol. Its IUPAC name is 2-isocyanatoethyl 2-isocyanatopropanoate.
Molecular Properties
| Compound Name | 2-isocyanatoethyl 2-isocyanatopropanoate |
| PubChem CID | 21427725 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 2-isocyanatoethyl 2-isocyanatopropanoate |
| SMILES | CC(N=C=O)C(=O)OCCN=C=O |
| InChI | InChI=1S/C7H8N2O4/c1-6(9-5-11)7(12)13-3-2-8-4-10/h6H,2-3H2,1H3 |
| InChIKey | GJQWGDRIRFBJIG-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanatoethyl 2-isocyanatopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanatoethyl 2-isocyanatopropanoate?
The IUPAC name of 2-isocyanatoethyl 2-isocyanatopropanoate (CID 21427725) is 2-isocyanatoethyl 2-isocyanatopropanoate.
What is the SMILES notation for 2-isocyanatoethyl 2-isocyanatopropanoate?
The canonical SMILES for 2-isocyanatoethyl 2-isocyanatopropanoate is CC(N=C=O)C(=O)OCCN=C=O.
What is the InChIKey of 2-isocyanatoethyl 2-isocyanatopropanoate?
The InChIKey is GJQWGDRIRFBJIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c1-6(9-5-11)7(12)13-3-2-8-4-10/h6H,2-3H2,1H3.
What are the key properties of 2-isocyanatoethyl 2-isocyanatopropanoate?
2-isocyanatoethyl 2-isocyanatopropanoate has a molecular weight of 184.15 g/mol, XLogP of -0.41, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanatoethyl 2-isocyanatopropanoate is sourced from PubChem (CID 21427725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).