C14H17F7O3Si — CID 21428417
diethoxy-methyl-[3-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethyl]phenyl]silane (PubChem CID 21428417) has the molecular formula C14H17F7O3Si and a molecular weight of 394.36 g/mol. Its IUPAC name is diethoxy-methyl-[3-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethyl]phenyl]silane.
| Compound Name | diethoxy-methyl-[3-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethyl]phenyl]silane |
|---|---|
| PubChem CID | 21428417 |
| Molecular Formula | C14H17F7O3Si |
| Molecular Weight | 394.36 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | diethoxy-methyl-[3-[1,1,2,2-tetrafluoro-2-(trifluoromethoxy)ethyl]phenyl]silane |
| SMILES | CCO[Si](C)(OCC)c1cccc(C(F)(F)C(F)(F)OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F7O3Si/c1-4-22-25(3,23-5-2)11-8-6-7-10(9-11)12(15,16)13(17,18)24-14(19,20)21/h6-9H,4-5H2,1-3H3 |
| InChIKey | XDQGYUAESXLKLB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|