C32H41N3O8 — CID 21428614
2-[3-[3-(6,7-dimethoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)propylamino]propyl]-6,7-dimethoxy-4,4-dimethylisoquinoline-1,3-dione (PubChem CID 21428614) has the molecular formula C32H41N3O8 and a molecular weight of 595.69 g/mol. Its IUPAC name is 2-[3-[3-(6,7-dimethoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)propylamino]propyl]-6,7-dimethoxy-4,4-dimethylisoquinoline-1,3-dione.
| Compound Name | 2-[3-[3-(6,7-dimethoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)propylamino]propyl]-6,7-dimethoxy-4,4-dimethylisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 21428614 |
| Molecular Formula | C32H41N3O8 |
| Molecular Weight | 595.69 g/mol |
| Exact Mass | 595.29 |
| IUPAC Name | 2-[3-[3-(6,7-dimethoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)propylamino]propyl]-6,7-dimethoxy-4,4-dimethylisoquinoline-1,3-dione |
| SMILES | COc1cc2c(cc1OC)C(C)(C)C(=O)N(CCCNCCCN1C(=O)c3cc(OC)c(OC)cc3C(C)(C)C1=O)C2=O |
| InChI | InChI=1S/C32H41N3O8/c1-31(2)21-17-25(42-7)23(40-5)15-19(21)27(36)34(29(31)38)13-9-11-33-12-10-14-35-28(37)20-16-24(41-6)26(43-8)18-22(20)32(3,4)30(35)39/h15-18,33H,9-14H2,1-8H3 |
| InChIKey | RWYUXGKEQIXTEM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.69 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|