C11H9FO3 — CID 21428655
7-fluoro-4,4-dimethylisochromene-1,3-dione (PubChem CID 21428655) has the molecular formula C11H9FO3 and a molecular weight of 208.19 g/mol. Its IUPAC name is 7-fluoro-4,4-dimethylisochromene-1,3-dione.
| Compound Name | 7-fluoro-4,4-dimethylisochromene-1,3-dione |
|---|---|
| PubChem CID | 21428655 |
| Molecular Formula | C11H9FO3 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 7-fluoro-4,4-dimethylisochromene-1,3-dione |
| SMILES | CC1(C)C(=O)OC(=O)c2cc(F)ccc21 |
| InChI | InChI=1S/C11H9FO3/c1-11(2)8-4-3-6(12)5-7(8)9(13)15-10(11)14/h3-5H,1-2H3 |
| InChIKey | BMVUHHDVQGVRGI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|