C30H37N3O6 — CID 21428660
7-methoxy-2-[3-[3-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)propylamino]propyl]-4,4-dimethylisoquinoline-1,3-dione (PubChem CID 21428660) has the molecular formula C30H37N3O6 and a molecular weight of 535.64 g/mol. Its IUPAC name is 7-methoxy-2-[3-[3-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)propylamino]propyl]-4,4-dimethylisoquinoline-1,3-dione.
| Compound Name | 7-methoxy-2-[3-[3-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)propylamino]propyl]-4,4-dimethylisoquinoline-1,3-dione |
|---|---|
| PubChem CID | 21428660 |
| Molecular Formula | C30H37N3O6 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | 7-methoxy-2-[3-[3-(7-methoxy-4,4-dimethyl-1,3-dioxoisoquinolin-2-yl)propylamino]propyl]-4,4-dimethylisoquinoline-1,3-dione |
| SMILES | COc1ccc2c(c1)C(=O)N(CCCNCCCN1C(=O)c3cc(OC)ccc3C(C)(C)C1=O)C(=O)C2(C)C |
| InChI | InChI=1S/C30H37N3O6/c1-29(2)23-11-9-19(38-5)17-21(23)25(34)32(27(29)36)15-7-13-31-14-8-16-33-26(35)22-18-20(39-6)10-12-24(22)30(3,4)28(33)37/h9-12,17-18,31H,7-8,13-16H2,1-6H3 |
| InChIKey | KZUUPSGKNJTBBI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|