About 4,4,7-trimethylisothiochromene-1,3-dione
4,4,7-trimethylisothiochromene-1,3-dione (PubChem CID 21428690) has the molecular formula C12H12O2S
and a molecular weight of 220.29 g/mol. Its IUPAC name is 4,4,7-trimethylisothiochromene-1,3-dione.
Molecular Properties
| Compound Name | 4,4,7-trimethylisothiochromene-1,3-dione |
| PubChem CID | 21428690 |
| Molecular Formula | C12H12O2S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 4,4,7-trimethylisothiochromene-1,3-dione |
| SMILES | Cc1ccc2c(c1)C(=O)SC(=O)C2(C)C |
| InChI | InChI=1S/C12H12O2S/c1-7-4-5-9-8(6-7)10(13)15-11(14)12(9,2)3/h4-6H,1-3H3 |
| InChIKey | HSJSYIYADNESQZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4,4,7-trimethylisothiochromene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4,7-trimethylisothiochromene-1,3-dione?
The IUPAC name of 4,4,7-trimethylisothiochromene-1,3-dione (CID 21428690) is 4,4,7-trimethylisothiochromene-1,3-dione.
What is the SMILES notation for 4,4,7-trimethylisothiochromene-1,3-dione?
The canonical SMILES for 4,4,7-trimethylisothiochromene-1,3-dione is Cc1ccc2c(c1)C(=O)SC(=O)C2(C)C.
What is the InChIKey of 4,4,7-trimethylisothiochromene-1,3-dione?
The InChIKey is HSJSYIYADNESQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2S/c1-7-4-5-9-8(6-7)10(13)15-11(14)12(9,2)3/h4-6H,1-3H3.
What are the key properties of 4,4,7-trimethylisothiochromene-1,3-dione?
4,4,7-trimethylisothiochromene-1,3-dione has a molecular weight of 220.29 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4,7-trimethylisothiochromene-1,3-dione is sourced from PubChem (CID 21428690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).