C25H23F4NS — CID 21428742
1-(cyclopropylmethyl)-4-[5-fluoro-14-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenylidene]piperidine (PubChem CID 21428742) has the molecular formula C25H23F4NS and a molecular weight of 445.53 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-[5-fluoro-14-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenylidene]piperidine.
| Compound Name | 1-(cyclopropylmethyl)-4-[5-fluoro-14-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenylidene]piperidine |
|---|---|
| PubChem CID | 21428742 |
| Molecular Formula | C25H23F4NS |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-[5-fluoro-14-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenylidene]piperidine |
| SMILES | Fc1ccc2c(c1)C(=C1CCN(CC3CC3)CC1)c1cc(SC(F)(F)F)ccc1C=C2 |
| InChI | InChI=1S/C25H23F4NS/c26-20-7-5-17-3-4-18-6-8-21(31-25(27,28)29)14-23(18)24(22(17)13-20)19-9-11-30(12-10-19)15-16-1-2-16/h3-8,13-14,16H,1-2,9-12,15H2 |
| InChIKey | YGLDMFDFPUXRQY-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|