C26H26F3NO2S — CID 21428743
1-(cyclopropylmethyl)-4-[5-methyl-14-(trifluoromethylsulfonyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenylidene]piperidine (PubChem CID 21428743) has the molecular formula C26H26F3NO2S and a molecular weight of 473.56 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-4-[5-methyl-14-(trifluoromethylsulfonyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenylidene]piperidine.
| Compound Name | 1-(cyclopropylmethyl)-4-[5-methyl-14-(trifluoromethylsulfonyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenylidene]piperidine |
|---|---|
| PubChem CID | 21428743 |
| Molecular Formula | C26H26F3NO2S |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 1-(cyclopropylmethyl)-4-[5-methyl-14-(trifluoromethylsulfonyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaenylidene]piperidine |
| SMILES | Cc1ccc2c(c1)C(=C1CCN(CC3CC3)CC1)c1cc(S(=O)(=O)C(F)(F)F)ccc1C=C2 |
| InChI | InChI=1S/C26H26F3NO2S/c1-17-2-5-19-6-7-20-8-9-22(33(31,32)26(27,28)29)15-24(20)25(23(19)14-17)21-10-12-30(13-11-21)16-18-3-4-18/h2,5-9,14-15,18H,3-4,10-13,16H2,1H3 |
| InChIKey | HHXZZZXGDATMSC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|