C16H11IO — CID 21428755
5-iodo-14-methyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one (PubChem CID 21428755) has the molecular formula C16H11IO and a molecular weight of 346.17 g/mol. Its IUPAC name is 5-iodo-14-methyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one.
| Compound Name | 5-iodo-14-methyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
|---|---|
| PubChem CID | 21428755 |
| Molecular Formula | C16H11IO |
| Molecular Weight | 346.17 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 5-iodo-14-methyltricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
| SMILES | Cc1ccc2ccc3ccc(I)cc3c(=O)c2c1 |
| InChI | InChI=1S/C16H11IO/c1-10-2-3-11-4-5-12-6-7-13(17)9-15(12)16(18)14(11)8-10/h2-9H,1H3 |
| InChIKey | WDOTUNJZHDVLNU-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.17 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|