C22H20F3NS — CID 21428762
1-methyl-4-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidine (PubChem CID 21428762) has the molecular formula C22H20F3NS and a molecular weight of 387.47 g/mol. Its IUPAC name is 1-methyl-4-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidine.
| Compound Name | 1-methyl-4-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidine |
|---|---|
| PubChem CID | 21428762 |
| Molecular Formula | C22H20F3NS |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-methyl-4-[5-(trifluoromethylsulfanyl)-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,9,11,13-heptaenylidene]piperidine |
| SMILES | CN1CCC(=C2c3ccccc3C=Cc3ccc(SC(F)(F)F)cc32)CC1 |
| InChI | InChI=1S/C22H20F3NS/c1-26-12-10-17(11-13-26)21-19-5-3-2-4-15(19)6-7-16-8-9-18(14-20(16)21)27-22(23,24)25/h2-9,14H,10-13H2,1H3 |
| InChIKey | OOKWWCABRCCCTR-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|