C6H11NS2 — CID 21429012
2,3,5,6,7,8a-hexahydro-[1,3]thiazolo[2,3-b][1,3]thiazine (PubChem CID 21429012) has the molecular formula C6H11NS2 and a molecular weight of 161.29 g/mol. Its IUPAC name is 2,3,5,6,7,8a-hexahydro-[1,3]thiazolo[2,3-b][1,3]thiazine.
| Compound Name | 2,3,5,6,7,8a-hexahydro-[1,3]thiazolo[2,3-b][1,3]thiazine |
|---|---|
| PubChem CID | 21429012 |
| Molecular Formula | C6H11NS2 |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 2,3,5,6,7,8a-hexahydro-[1,3]thiazolo[2,3-b][1,3]thiazine |
| SMILES | C1CSC2SCCN2C1 |
| InChI | InChI=1S/C6H11NS2/c1-2-7-3-5-9-6(7)8-4-1/h6H,1-5H2 |
| InChIKey | DWFHNIBQEYHZBI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |