C17H21NO2 — CID 21429239
(6-tert-butyl-3-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl) N-methylcarbamate (PubChem CID 21429239) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (6-tert-butyl-3-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl) N-methylcarbamate.
| Compound Name | (6-tert-butyl-3-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl) N-methylcarbamate |
|---|---|
| PubChem CID | 21429239 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (6-tert-butyl-3-tricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraenyl) N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc(C(C)(C)C)c2c1C1C=CC2C1 |
| InChI | InChI=1S/C17H21NO2/c1-17(2,3)12-7-8-13(20-16(19)18-4)15-11-6-5-10(9-11)14(12)15/h5-8,10-11H,9H2,1-4H3,(H,18,19) |
| InChIKey | NXCJTQLBWXFJBU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|