About 2-(6-methylnonyl)-1,3-oxathiolane
2-(6-methylnonyl)-1,3-oxathiolane (PubChem CID 21429350) has the molecular formula C13H26OS
and a molecular weight of 230.42 g/mol. Its IUPAC name is 2-(6-methylnonyl)-1,3-oxathiolane.
Molecular Properties
| Compound Name | 2-(6-methylnonyl)-1,3-oxathiolane |
| PubChem CID | 21429350 |
| Molecular Formula | C13H26OS |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 2-(6-methylnonyl)-1,3-oxathiolane |
| SMILES | CCCC(C)CCCCCC1OCCS1 |
| InChI | InChI=1S/C13H26OS/c1-3-7-12(2)8-5-4-6-9-13-14-10-11-15-13/h12-13H,3-11H2,1-2H3 |
| InChIKey | QLMNJRBTYKFEGC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-methylnonyl)-1,3-oxathiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methylnonyl)-1,3-oxathiolane?
The IUPAC name of 2-(6-methylnonyl)-1,3-oxathiolane (CID 21429350) is 2-(6-methylnonyl)-1,3-oxathiolane.
What is the SMILES notation for 2-(6-methylnonyl)-1,3-oxathiolane?
The canonical SMILES for 2-(6-methylnonyl)-1,3-oxathiolane is CCCC(C)CCCCCC1OCCS1.
What is the InChIKey of 2-(6-methylnonyl)-1,3-oxathiolane?
The InChIKey is QLMNJRBTYKFEGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26OS/c1-3-7-12(2)8-5-4-6-9-13-14-10-11-15-13/h12-13H,3-11H2,1-2H3.
What are the key properties of 2-(6-methylnonyl)-1,3-oxathiolane?
2-(6-methylnonyl)-1,3-oxathiolane has a molecular weight of 230.42 g/mol, XLogP of 4.46, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methylnonyl)-1,3-oxathiolane is sourced from PubChem (CID 21429350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).