C17H17ClN8O6S2 — CID 21429693
4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[[4-(dimethylamino)-3-sulfophenyl]diazenyl]benzenesulfonic acid (PubChem CID 21429693) has the molecular formula C17H17ClN8O6S2 and a molecular weight of 528.96 g/mol. Its IUPAC name is 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[[4-(dimethylamino)-3-sulfophenyl]diazenyl]benzenesulfonic acid.
| Compound Name | 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[[4-(dimethylamino)-3-sulfophenyl]diazenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 21429693 |
| Molecular Formula | C17H17ClN8O6S2 |
| Molecular Weight | 528.96 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 4-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-[[4-(dimethylamino)-3-sulfophenyl]diazenyl]benzenesulfonic acid |
| SMILES | CN(C)c1ccc(/N=N/c2cc(Nc3nc(N)nc(Cl)n3)ccc2S(=O)(=O)O)cc1S(=O)(=O)O |
| InChI | InChI=1S/C17H17ClN8O6S2/c1-26(2)12-5-3-10(8-14(12)34(30,31)32)24-25-11-7-9(4-6-13(11)33(27,28)29)20-17-22-15(18)21-16(19)23-17/h3-8H,1-2H3,(H,27,28,29)(H,30,31,32)(H3,19,20,21,22,23)/b25-24+ |
| InChIKey | RGXYTMRZRNBYNI-OCOZRVBESA-N |
| XLogP | 2.83 |
| TPSA | 213.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.96 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|