About 2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol
2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol (PubChem CID 21429941) has the molecular formula C7H8Cl3N3O
and a molecular weight of 256.52 g/mol. Its IUPAC name is 2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol |
| PubChem CID | 21429941 |
| Molecular Formula | C7H8Cl3N3O |
| Molecular Weight | 256.52 g/mol |
| Exact Mass | 254.97 |
| IUPAC Name | 2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol |
| SMILES | CN(CCO)c1nc(Cl)c(Cl)nc1Cl |
| InChI | InChI=1S/C7H8Cl3N3O/c1-13(2-3-14)7-6(10)11-4(8)5(9)12-7/h14H,2-3H2,1H3 |
| InChIKey | PHKVUVPZGTUYOK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol?
The IUPAC name of 2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol (CID 21429941) is 2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol.
What is the SMILES notation for 2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol?
The canonical SMILES for 2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol is CN(CCO)c1nc(Cl)c(Cl)nc1Cl.
What is the InChIKey of 2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol?
The InChIKey is PHKVUVPZGTUYOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8Cl3N3O/c1-13(2-3-14)7-6(10)11-4(8)5(9)12-7/h14H,2-3H2,1H3.
What are the key properties of 2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol?
2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol has a molecular weight of 256.52 g/mol, XLogP of 1.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-(3,5,6-trichloropyrazin-2-yl)amino]ethanol is sourced from PubChem (CID 21429941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).