About 6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid
6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 21430051) has the molecular formula C7H7Cl2NO2
and a molecular weight of 208.04 g/mol. Its IUPAC name is 6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 21430051 |
| Molecular Formula | C7H7Cl2NO2 |
| Molecular Weight | 208.04 g/mol |
| Exact Mass | 206.99 |
| IUPAC Name | 6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | NC1(Cl)C=CC(Cl)=CC1C(=O)O |
| InChI | InChI=1S/C7H7Cl2NO2/c8-4-1-2-7(9,10)5(3-4)6(11)12/h1-3,5H,10H2,(H,11,12) |
| InChIKey | QHDXTGGMGAPOGJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.04 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid (CID 21430051) is 6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid is NC1(Cl)C=CC(Cl)=CC1C(=O)O.
What is the InChIKey of 6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is QHDXTGGMGAPOGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl2NO2/c8-4-1-2-7(9,10)5(3-4)6(11)12/h1-3,5H,10H2,(H,11,12).
What are the key properties of 6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid?
6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 208.04 g/mol, XLogP of 1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3,6-dichlorocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 21430051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).