About 2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide
2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide (PubChem CID 21430129) has the molecular formula C12H17Br2ClN2
and a molecular weight of 384.54 g/mol. Its IUPAC name is 2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide.
Molecular Properties
| Compound Name | 2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide |
| PubChem CID | 21430129 |
| Molecular Formula | C12H17Br2ClN2 |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 381.94 |
| IUPAC Name | 2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide |
| SMILES | Br.CC/N=C(/Cc1ccc(Br)c(Cl)c1)NCC |
| InChI | InChI=1S/C12H16BrClN2.BrH/c1-3-15-12(16-4-2)8-9-5-6-10(13)11(14)7-9;/h5-7H,3-4,8H2,1-2H3,(H,15,16);1H |
| InChIKey | CAWURYSHSNCQQB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide?
The IUPAC name of 2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide (CID 21430129) is 2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide.
What is the SMILES notation for 2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide?
The canonical SMILES for 2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide is Br.CC/N=C(/Cc1ccc(Br)c(Cl)c1)NCC.
What is the InChIKey of 2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide?
The InChIKey is CAWURYSHSNCQQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16BrClN2.BrH/c1-3-15-12(16-4-2)8-9-5-6-10(13)11(14)7-9;/h5-7H,3-4,8H2,1-2H3,(H,15,16);1H.
What are the key properties of 2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide?
2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide has a molecular weight of 384.54 g/mol, XLogP of 4.25, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromo-3-chlorophenyl)-N,N'-diethylethanimidamide;hydrobromide is sourced from PubChem (CID 21430129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).