C22H28N2O2 — CID 21430565
N-[1-(4-hydroxy-4-phenylbutyl)piperidin-4-yl]benzamide (PubChem CID 21430565) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-[1-(4-hydroxy-4-phenylbutyl)piperidin-4-yl]benzamide.
| Compound Name | N-[1-(4-hydroxy-4-phenylbutyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 21430565 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N-[1-(4-hydroxy-4-phenylbutyl)piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(CCCC(O)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O2/c25-21(18-8-3-1-4-9-18)12-7-15-24-16-13-20(14-17-24)23-22(26)19-10-5-2-6-11-19/h1-6,8-11,20-21,25H,7,12-17H2,(H,23,26) |
| InChIKey | RMFXVYPCROJQOL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |