C12H20O3 — CID 21430990
ethyl 2-hydroxy-2,6,6-trimethylcyclohex-3-ene-1-carboxylate (PubChem CID 21430990) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is ethyl 2-hydroxy-2,6,6-trimethylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 2-hydroxy-2,6,6-trimethylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 21430990 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | ethyl 2-hydroxy-2,6,6-trimethylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(C)(O)C=CCC1(C)C |
| InChI | InChI=1S/C12H20O3/c1-5-15-10(13)9-11(2,3)7-6-8-12(9,4)14/h6,8-9,14H,5,7H2,1-4H3 |
| InChIKey | PREHEHKBFUMLNS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|