C17H22O4 — CID 21432281
[2,5,7,8-tetramethyl-2-(2-oxoethyl)-3,4-dihydrochromen-6-yl] acetate (PubChem CID 21432281) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is [2,5,7,8-tetramethyl-2-(2-oxoethyl)-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2,5,7,8-tetramethyl-2-(2-oxoethyl)-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 21432281 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [2,5,7,8-tetramethyl-2-(2-oxoethyl)-3,4-dihydrochromen-6-yl] acetate |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(CC=O)O2 |
| InChI | InChI=1S/C17H22O4/c1-10-11(2)16-14(12(3)15(10)20-13(4)19)6-7-17(5,21-16)8-9-18/h9H,6-8H2,1-5H3 |
| InChIKey | DJEBIKPISWEXMG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|