About butanamide;pentanamide
butanamide;pentanamide (PubChem CID 21432412) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is butanamide;pentanamide.
Molecular Properties
| Compound Name | butanamide;pentanamide |
| PubChem CID | 21432412 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | butanamide;pentanamide |
| SMILES | CCCC(N)=O.CCCCC(N)=O |
| InChI | InChI=1S/C5H11NO.C4H9NO/c1-2-3-4-5(6)7;1-2-3-4(5)6/h2-4H2,1H3,(H2,6,7);2-3H2,1H3,(H2,5,6) |
| InChIKey | AOGUNMFXTKCLLO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butanamide;pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanamide;pentanamide?
The IUPAC name of butanamide;pentanamide (CID 21432412) is butanamide;pentanamide.
What is the SMILES notation for butanamide;pentanamide?
The canonical SMILES for butanamide;pentanamide is CCCC(N)=O.CCCCC(N)=O.
What is the InChIKey of butanamide;pentanamide?
The InChIKey is AOGUNMFXTKCLLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C4H9NO/c1-2-3-4-5(6)7;1-2-3-4(5)6/h2-4H2,1H3,(H2,6,7);2-3H2,1H3,(H2,5,6).
What are the key properties of butanamide;pentanamide?
butanamide;pentanamide has a molecular weight of 188.27 g/mol, XLogP of 0.93, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butanamide;pentanamide is sourced from PubChem (CID 21432412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).