C24H32O5 — CID 21432625
acetyl (2E,4E,6E,8E)-9-(5-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoate (PubChem CID 21432625) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is acetyl (2E,4E,6E,8E)-9-(5-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoate.
| Compound Name | acetyl (2E,4E,6E,8E)-9-(5-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 21432625 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | acetyl (2E,4E,6E,8E)-9-(5-acetyloxy-2,6,6-trimethylcyclohexen-1-yl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
| SMILES | CC(=O)OC(=O)/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)CCC(OC(C)=O)C1(C)C |
| InChI | InChI=1S/C24H32O5/c1-16(9-8-10-17(2)15-23(27)29-20(5)26)11-13-21-18(3)12-14-22(24(21,6)7)28-19(4)25/h8-11,13,15,22H,12,14H2,1-7H3/b10-8+,13-11+,16-9+,17-15+ |
| InChIKey | LAYLWIXTMJGKJQ-KGQIXEFNSA-N |
| XLogP | 5.15 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|