C10H16ClN3S2 — CID 21432758
1-methyl-3-(3-pyridin-2-ylsulfanylpropyl)thiourea;hydrochloride (PubChem CID 21432758) has the molecular formula C10H16ClN3S2 and a molecular weight of 277.85 g/mol. Its IUPAC name is 1-methyl-3-(3-pyridin-2-ylsulfanylpropyl)thiourea;hydrochloride.
| Compound Name | 1-methyl-3-(3-pyridin-2-ylsulfanylpropyl)thiourea;hydrochloride |
|---|---|
| PubChem CID | 21432758 |
| Molecular Formula | C10H16ClN3S2 |
| Molecular Weight | 277.85 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 1-methyl-3-(3-pyridin-2-ylsulfanylpropyl)thiourea;hydrochloride |
| SMILES | CNC(=S)NCCCSc1ccccn1.Cl |
| InChI | InChI=1S/C10H15N3S2.ClH/c1-11-10(14)13-7-4-8-15-9-5-2-3-6-12-9;/h2-3,5-6H,4,7-8H2,1H3,(H2,11,13,14);1H |
| InChIKey | RFVXMANTQNQSAU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.85 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|