C22H46S — CID 21432942
2,4,4,6,6,8,8-heptamethylpentadecane-2-thiol (PubChem CID 21432942) has the molecular formula C22H46S and a molecular weight of 342.68 g/mol. Its IUPAC name is 2,4,4,6,6,8,8-heptamethylpentadecane-2-thiol.
| Compound Name | 2,4,4,6,6,8,8-heptamethylpentadecane-2-thiol |
|---|---|
| PubChem CID | 21432942 |
| Molecular Formula | C22H46S |
| Molecular Weight | 342.68 g/mol |
| Exact Mass | 342.33 |
| IUPAC Name | 2,4,4,6,6,8,8-heptamethylpentadecane-2-thiol |
| SMILES | CCCCCCCC(C)(C)CC(C)(C)CC(C)(C)CC(C)(C)S |
| InChI | InChI=1S/C22H46S/c1-10-11-12-13-14-15-19(2,3)16-20(4,5)17-21(6,7)18-22(8,9)23/h23H,10-18H2,1-9H3 |
| InChIKey | JUZDSPCADGMYEG-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.68 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|