About 6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride
6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride (PubChem CID 21433271) has the molecular formula C10H18Cl2N4
and a molecular weight of 265.19 g/mol. Its IUPAC name is 6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride |
| PubChem CID | 21433271 |
| Molecular Formula | C10H18Cl2N4 |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride |
| SMILES | CCCCCCNc1cc(Cl)nc(N)n1.Cl |
| InChI | InChI=1S/C10H17ClN4.ClH/c1-2-3-4-5-6-13-9-7-8(11)14-10(12)15-9;/h7H,2-6H2,1H3,(H3,12,13,14,15);1H |
| InChIKey | XXYLZJHETNQBBK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride?
The IUPAC name of 6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride (CID 21433271) is 6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride.
What is the SMILES notation for 6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride?
The canonical SMILES for 6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride is CCCCCCNc1cc(Cl)nc(N)n1.Cl.
What is the InChIKey of 6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride?
The InChIKey is XXYLZJHETNQBBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClN4.ClH/c1-2-3-4-5-6-13-9-7-8(11)14-10(12)15-9;/h7H,2-6H2,1H3,(H3,12,13,14,15);1H.
What are the key properties of 6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride?
6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride has a molecular weight of 265.19 g/mol, XLogP of 3.13, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-N-hexylpyrimidine-2,4-diamine;hydrochloride is sourced from PubChem (CID 21433271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).