About 4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one
4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one (PubChem CID 21433537) has the molecular formula C14H15BrO
and a molecular weight of 279.18 g/mol. Its IUPAC name is 4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one.
Molecular Properties
| Compound Name | 4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one |
| PubChem CID | 21433537 |
| Molecular Formula | C14H15BrO |
| Molecular Weight | 279.18 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one |
| SMILES | O=C1CCC2(CC1)Cc1cccc(Br)c1C2 |
| InChI | InChI=1S/C14H15BrO/c15-13-3-1-2-10-8-14(9-12(10)13)6-4-11(16)5-7-14/h1-3H,4-9H2 |
| InChIKey | FUNZANATVMEFFU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.18 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one?
The IUPAC name of 4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one (CID 21433537) is 4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one.
What is the SMILES notation for 4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one?
The canonical SMILES for 4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one is O=C1CCC2(CC1)Cc1cccc(Br)c1C2.
What is the InChIKey of 4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one?
The InChIKey is FUNZANATVMEFFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrO/c15-13-3-1-2-10-8-14(9-12(10)13)6-4-11(16)5-7-14/h1-3H,4-9H2.
What are the key properties of 4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one?
4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one has a molecular weight of 279.18 g/mol, XLogP of 3.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one is sourced from PubChem (CID 21433537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).