About 1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene
1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene (PubChem CID 21433564) has the molecular formula C16H21NO
and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene.
Molecular Properties
| Compound Name | 1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene |
| PubChem CID | 21433564 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene |
| SMILES | C=C.NC1c2ccccc2CC12CCC(=O)CC2 |
| InChI | InChI=1S/C14H17NO.C2H4/c15-13-12-4-2-1-3-10(12)9-14(13)7-5-11(16)6-8-14;1-2/h1-4,13H,5-9,15H2;1-2H2 |
| InChIKey | NZAVOWLPEXHYDR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene?
The IUPAC name of 1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene (CID 21433564) is 1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene.
What is the SMILES notation for 1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene?
The canonical SMILES for 1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene is C=C.NC1c2ccccc2CC12CCC(=O)CC2.
What is the InChIKey of 1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene?
The InChIKey is NZAVOWLPEXHYDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO.C2H4/c15-13-12-4-2-1-3-10(12)9-14(13)7-5-11(16)6-8-14;1-2/h1-4,13H,5-9,15H2;1-2H2.
What are the key properties of 1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene?
1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene has a molecular weight of 243.35 g/mol, XLogP of 3.17, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one;ethene is sourced from PubChem (CID 21433564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).