About ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one
ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one (PubChem CID 21433676) has the molecular formula C16H19FO
and a molecular weight of 246.32 g/mol. Its IUPAC name is ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one.
Molecular Properties
| Compound Name | ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one |
| PubChem CID | 21433676 |
| Molecular Formula | C16H19FO |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one |
| SMILES | C=C.O=C1CCC2(CC1)Cc1cccc(F)c1C2 |
| InChI | InChI=1S/C14H15FO.C2H4/c15-13-3-1-2-10-8-14(9-12(10)13)6-4-11(16)5-7-14;1-2/h1-3H,4-9H2;1-2H2 |
| InChIKey | HHMJIJHBXVQUJX-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one?
The IUPAC name of ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one (CID 21433676) is ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one.
What is the SMILES notation for ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one?
The canonical SMILES for ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one is C=C.O=C1CCC2(CC1)Cc1cccc(F)c1C2.
What is the InChIKey of ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one?
The InChIKey is HHMJIJHBXVQUJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15FO.C2H4/c15-13-3-1-2-10-8-14(9-12(10)13)6-4-11(16)5-7-14;1-2/h1-3H,4-9H2;1-2H2.
What are the key properties of ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one?
ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one has a molecular weight of 246.32 g/mol, XLogP of 3.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;4-fluorospiro[1,3-dihydroindene-2,4'-cyclohexane]-1'-one is sourced from PubChem (CID 21433676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).