C16H21NO — CID 21433683
N-spiro[1,3-dihydroindene-2,1'-cyclohexane]-1-ylacetamide (PubChem CID 21433683) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is N-spiro[1,3-dihydroindene-2,1'-cyclohexane]-1-ylacetamide.
| Compound Name | N-spiro[1,3-dihydroindene-2,1'-cyclohexane]-1-ylacetamide |
|---|---|
| PubChem CID | 21433683 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | N-spiro[1,3-dihydroindene-2,1'-cyclohexane]-1-ylacetamide |
| SMILES | CC(=O)NC1c2ccccc2CC12CCCCC2 |
| InChI | InChI=1S/C16H21NO/c1-12(18)17-15-14-8-4-3-7-13(14)11-16(15)9-5-2-6-10-16/h3-4,7-8,15H,2,5-6,9-11H2,1H3,(H,17,18) |
| InChIKey | ALQPMYGUEALEOI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |