C25H23BrN2O3S — CID 21434123
N-[4-(4-bromophenyl)sulfinylphenyl]-3-tert-butyl-5-cyano-2-hydroxy-6-methylbenzamide (PubChem CID 21434123) has the molecular formula C25H23BrN2O3S and a molecular weight of 511.44 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)sulfinylphenyl]-3-tert-butyl-5-cyano-2-hydroxy-6-methylbenzamide.
| Compound Name | N-[4-(4-bromophenyl)sulfinylphenyl]-3-tert-butyl-5-cyano-2-hydroxy-6-methylbenzamide |
|---|---|
| PubChem CID | 21434123 |
| Molecular Formula | C25H23BrN2O3S |
| Molecular Weight | 511.44 g/mol |
| Exact Mass | 510.06 |
| IUPAC Name | N-[4-(4-bromophenyl)sulfinylphenyl]-3-tert-butyl-5-cyano-2-hydroxy-6-methylbenzamide |
| SMILES | Cc1c(C#N)cc(C(C)(C)C)c(O)c1C(=O)Nc1ccc(S(=O)c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C25H23BrN2O3S/c1-15-16(14-27)13-21(25(2,3)4)23(29)22(15)24(30)28-18-7-11-20(12-8-18)32(31)19-9-5-17(26)6-10-19/h5-13,29H,1-4H3,(H,28,30) |
| InChIKey | FPJIOZSXDIVRKS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.44 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |