About 2-chloro-1,3,4-tris(ethenyl)benzene
2-chloro-1,3,4-tris(ethenyl)benzene (PubChem CID 21434290) has the molecular formula C12H11Cl
and a molecular weight of 190.67 g/mol. Its IUPAC name is 2-chloro-1,3,4-tris(ethenyl)benzene.
Molecular Properties
| Compound Name | 2-chloro-1,3,4-tris(ethenyl)benzene |
| PubChem CID | 21434290 |
| Molecular Formula | C12H11Cl |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 2-chloro-1,3,4-tris(ethenyl)benzene |
| SMILES | C=Cc1ccc(C=C)c(C=C)c1Cl |
| InChI | InChI=1S/C12H11Cl/c1-4-9-7-8-10(5-2)12(13)11(9)6-3/h4-8H,1-3H2 |
| InChIKey | IVZYEHMJJDFFSI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-chloro-1,3,4-tris(ethenyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3,4-tris(ethenyl)benzene?
The IUPAC name of 2-chloro-1,3,4-tris(ethenyl)benzene (CID 21434290) is 2-chloro-1,3,4-tris(ethenyl)benzene.
What is the SMILES notation for 2-chloro-1,3,4-tris(ethenyl)benzene?
The canonical SMILES for 2-chloro-1,3,4-tris(ethenyl)benzene is C=Cc1ccc(C=C)c(C=C)c1Cl.
What is the InChIKey of 2-chloro-1,3,4-tris(ethenyl)benzene?
The InChIKey is IVZYEHMJJDFFSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl/c1-4-9-7-8-10(5-2)12(13)11(9)6-3/h4-8H,1-3H2.
What are the key properties of 2-chloro-1,3,4-tris(ethenyl)benzene?
2-chloro-1,3,4-tris(ethenyl)benzene has a molecular weight of 190.67 g/mol, XLogP of 4.27, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3,4-tris(ethenyl)benzene is sourced from PubChem (CID 21434290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).