C12H20N6O2S — CID 21434545
2-[[4-[methyl(prop-2-enyl)amino]-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]ethyl N-methylcarbamate (PubChem CID 21434545) has the molecular formula C12H20N6O2S and a molecular weight of 312.40 g/mol. Its IUPAC name is 2-[[4-[methyl(prop-2-enyl)amino]-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]ethyl N-methylcarbamate.
| Compound Name | 2-[[4-[methyl(prop-2-enyl)amino]-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 21434545 |
| Molecular Formula | C12H20N6O2S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 2-[[4-[methyl(prop-2-enyl)amino]-6-methylsulfanyl-1,3,5-triazin-2-yl]amino]ethyl N-methylcarbamate |
| SMILES | C=CCN(C)c1nc(NCCOC(=O)NC)nc(SC)n1 |
| InChI | InChI=1S/C12H20N6O2S/c1-5-7-18(3)10-15-9(16-11(17-10)21-4)14-6-8-20-12(19)13-2/h5H,1,6-8H2,2-4H3,(H,13,19)(H,14,15,16,17) |
| InChIKey | CSADNNKMPVFQTO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|